About CID 139265108
CID 139265108 (PubChem CID 139265108) has the molecular formula C27H26BrNO4Se
and a molecular weight of 587.37 g/mol.
Molecular Properties
| Compound Name | CID 139265108 |
| PubChem CID | 139265108 |
| Molecular Formula | C27H26BrNO4Se |
| Molecular Weight | 587.37 g/mol |
| Exact Mass | 587.02 |
| IUPAC Name | — |
| SMILES | [Br-].[Se+]c1ccccc1CN1[C@H]2COC(c3ccccc3)O[C@H]2[C@@H]2OC(c3ccccc3)OC[C@@H]21 |
| InChI | InChI=1S/C27H26NO4Se.BrH/c33-23-14-8-7-13-20(23)15-28-21-16-29-26(18-9-3-1-4-10-18)31-24(21)25-22(28)17-30-27(32-25)19-11-5-2-6-12-19;/h1-14,21-22,24-27H,15-17H2;1H/q+1;/p-1/t21-,22-,24+,25+,26?,27?;/m0./s1 |
| InChIKey | ISCOSYADHAYGKI-WUXIEOFUSA-M |
| XLogP | 0.27 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 587.37 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 139265108 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 139265108?
The IUPAC name of CID 139265108 (CID 139265108) is not available.
What is the SMILES notation for CID 139265108?
The canonical SMILES for CID 139265108 is [Br-].[Se+]c1ccccc1CN1[C@H]2COC(c3ccccc3)O[C@H]2[C@@H]2OC(c3ccccc3)OC[C@@H]21.
What is the InChIKey of CID 139265108?
The InChIKey is ISCOSYADHAYGKI-WUXIEOFUSA-M. The full InChI is InChI=1S/C27H26NO4Se.BrH/c33-23-14-8-7-13-20(23)15-28-21-16-29-26(18-9-3-1-4-10-18)31-24(21)25-22(28)17-30-27(32-25)19-11-5-2-6-12-19;/h1-14,21-22,24-27H,15-17H2;1H/q+1;/p-1/t21-,22-,24+,25+,26?,27?;/m0./s1.
What are the key properties of CID 139265108?
CID 139265108 has a molecular weight of 587.37 g/mol, XLogP of 0.27, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 139265108 is sourced from PubChem (CID 139265108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).