About CID 139265111
CID 139265111 (PubChem CID 139265111) has the molecular formula C27H26F6NO4PSe
and a molecular weight of 652.43 g/mol.
Molecular Properties
| Compound Name | CID 139265111 |
| PubChem CID | 139265111 |
| Molecular Formula | C27H26F6NO4PSe |
| Molecular Weight | 652.43 g/mol |
| Exact Mass | 653.07 |
| IUPAC Name | — |
| SMILES | F[P-](F)(F)(F)(F)F.[Se+]c1ccccc1CN1[C@H]2COC(c3ccccc3)O[C@H]2[C@@H]2OC(c3ccccc3)OC[C@@H]21 |
| InChI | InChI=1S/C27H26NO4Se.F6P/c33-23-14-8-7-13-20(23)15-28-21-16-29-26(18-9-3-1-4-10-18)31-24(21)25-22(28)17-30-27(32-25)19-11-5-2-6-12-19;1-7(2,3,4,5)6/h1-14,21-22,24-27H,15-17H2;/q+1;-1/t21-,22-,24+,25+,26?,27?;/m0./s1 |
| InChIKey | HYEJAXBMIZHBLG-WUXIEOFUSA-N |
| XLogP | 6.64 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 652.43 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 139265111 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 139265111?
The IUPAC name of CID 139265111 (CID 139265111) is not available.
What is the SMILES notation for CID 139265111?
The canonical SMILES for CID 139265111 is F[P-](F)(F)(F)(F)F.[Se+]c1ccccc1CN1[C@H]2COC(c3ccccc3)O[C@H]2[C@@H]2OC(c3ccccc3)OC[C@@H]21.
What is the InChIKey of CID 139265111?
The InChIKey is HYEJAXBMIZHBLG-WUXIEOFUSA-N. The full InChI is InChI=1S/C27H26NO4Se.F6P/c33-23-14-8-7-13-20(23)15-28-21-16-29-26(18-9-3-1-4-10-18)31-24(21)25-22(28)17-30-27(32-25)19-11-5-2-6-12-19;1-7(2,3,4,5)6/h1-14,21-22,24-27H,15-17H2;/q+1;-1/t21-,22-,24+,25+,26?,27?;/m0./s1.
What are the key properties of CID 139265111?
CID 139265111 has a molecular weight of 652.43 g/mol, XLogP of 6.64, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 139265111 is sourced from PubChem (CID 139265111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).