C36H37NO5Se — CID 139265122
(1R,2R,7S,9S)-8-[[2-(2-methoxy-2-phenylethyl)selanylphenyl]methyl]-4,12-diphenyl-3,5,11,13-tetraoxa-8-azatricyclo[7.4.0.02,7]tridecane (PubChem CID 139265122) has the molecular formula C36H37NO5Se and a molecular weight of 642.65 g/mol. Its IUPAC name is (1R,2R,7S,9S)-8-[[2-(2-methoxy-2-phenylethyl)selanylphenyl]methyl]-4,12-diphenyl-3,5,11,13-tetraoxa-8-azatricyclo[7.4.0.02,7]tridecane.
| Compound Name | (1R,2R,7S,9S)-8-[[2-(2-methoxy-2-phenylethyl)selanylphenyl]methyl]-4,12-diphenyl-3,5,11,13-tetraoxa-8-azatricyclo[7.4.0.02,7]tridecane |
|---|---|
| PubChem CID | 139265122 |
| Molecular Formula | C36H37NO5Se |
| Molecular Weight | 642.65 g/mol |
| Exact Mass | 643.18 |
| IUPAC Name | (1R,2R,7S,9S)-8-[[2-(2-methoxy-2-phenylethyl)selanylphenyl]methyl]-4,12-diphenyl-3,5,11,13-tetraoxa-8-azatricyclo[7.4.0.02,7]tridecane |
| SMILES | COC(C[Se]c1ccccc1CN1[C@H]2COC(c3ccccc3)O[C@H]2[C@@H]2OC(c3ccccc3)OC[C@@H]21)c1ccccc1 |
| InChI | InChI=1S/C36H37NO5Se/c1-38-31(25-13-5-2-6-14-25)24-43-32-20-12-11-19-28(32)21-37-29-22-39-35(26-15-7-3-8-16-26)41-33(29)34-30(37)23-40-36(42-34)27-17-9-4-10-18-27/h2-20,29-31,33-36H,21-24H2,1H3/t29-,30-,31?,33+,34+,35?,36?/m0/s1 |
| InChIKey | HMZREGXWEKGRQJ-DHQMDQQDSA-N |
| XLogP | 5.60 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.65 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|