About dilithium;2-tert-butyl-4-methoxybenzene-6-id-1-olate
dilithium;2-tert-butyl-4-methoxybenzene-6-id-1-olate (PubChem CID 139265353) has the molecular formula C11H14Li2O2
and a molecular weight of 192.11 g/mol. Its IUPAC name is dilithium;2-tert-butyl-4-methoxybenzene-6-id-1-olate.
Molecular Properties
| Compound Name | dilithium;2-tert-butyl-4-methoxybenzene-6-id-1-olate |
| PubChem CID | 139265353 |
| Molecular Formula | C11H14Li2O2 |
| Molecular Weight | 192.11 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | dilithium;2-tert-butyl-4-methoxybenzene-6-id-1-olate |
| SMILES | COc1c[c-]c([O-])c(C(C)(C)C)c1.[Li+].[Li+] |
| InChI | InChI=1S/C11H15O2.2Li/c1-11(2,3)9-7-8(13-4)5-6-10(9)12;;/h5,7,12H,1-4H3;;/q-1;2*+1/p-1 |
| InChIKey | WHSDLKRCDVORQJ-UHFFFAOYSA-M |
| XLogP | -4.13 |
| TPSA | 32.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.11 |
| LogP ≤ 5 | -4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze dilithium;2-tert-butyl-4-methoxybenzene-6-id-1-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dilithium;2-tert-butyl-4-methoxybenzene-6-id-1-olate?
The IUPAC name of dilithium;2-tert-butyl-4-methoxybenzene-6-id-1-olate (CID 139265353) is dilithium;2-tert-butyl-4-methoxybenzene-6-id-1-olate.
What is the SMILES notation for dilithium;2-tert-butyl-4-methoxybenzene-6-id-1-olate?
The canonical SMILES for dilithium;2-tert-butyl-4-methoxybenzene-6-id-1-olate is COc1c[c-]c([O-])c(C(C)(C)C)c1.[Li+].[Li+].
What is the InChIKey of dilithium;2-tert-butyl-4-methoxybenzene-6-id-1-olate?
The InChIKey is WHSDLKRCDVORQJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H15O2.2Li/c1-11(2,3)9-7-8(13-4)5-6-10(9)12;;/h5,7,12H,1-4H3;;/q-1;2*+1/p-1.
What are the key properties of dilithium;2-tert-butyl-4-methoxybenzene-6-id-1-olate?
dilithium;2-tert-butyl-4-methoxybenzene-6-id-1-olate has a molecular weight of 192.11 g/mol, XLogP of -4.13, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dilithium;2-tert-butyl-4-methoxybenzene-6-id-1-olate is sourced from PubChem (CID 139265353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).