About [acetyloxy-(cyclopentylmethyl)-naphthalen-2-yl-λ4-tellanyl] acetate
[acetyloxy-(cyclopentylmethyl)-naphthalen-2-yl-λ4-tellanyl] acetate (PubChem CID 139265651) has the molecular formula C20H24O4Te
and a molecular weight of 456.01 g/mol. Its IUPAC name is [acetyloxy-(cyclopentylmethyl)-naphthalen-2-yl-λ4-tellanyl] acetate.
Molecular Properties
| Compound Name | [acetyloxy-(cyclopentylmethyl)-naphthalen-2-yl-λ4-tellanyl] acetate |
| PubChem CID | 139265651 |
| Molecular Formula | C20H24O4Te |
| Molecular Weight | 456.01 g/mol |
| Exact Mass | 458.07 |
| IUPAC Name | [acetyloxy-(cyclopentylmethyl)-naphthalen-2-yl-λ4-tellanyl] acetate |
| SMILES | CC(=O)O[Te](CC1CCCC1)(OC(C)=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C20H24O4Te/c1-15(21)23-25(24-16(2)22,14-17-7-3-4-8-17)20-12-11-18-9-5-6-10-19(18)13-20/h5-6,9-13,17H,3-4,7-8,14H2,1-2H3 |
| InChIKey | PFRYDNKZZRWNMD-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 456.01 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [acetyloxy-(cyclopentylmethyl)-naphthalen-2-yl-λ4-tellanyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [acetyloxy-(cyclopentylmethyl)-naphthalen-2-yl-λ4-tellanyl] acetate?
The IUPAC name of [acetyloxy-(cyclopentylmethyl)-naphthalen-2-yl-λ4-tellanyl] acetate (CID 139265651) is [acetyloxy-(cyclopentylmethyl)-naphthalen-2-yl-λ4-tellanyl] acetate.
What is the SMILES notation for [acetyloxy-(cyclopentylmethyl)-naphthalen-2-yl-λ4-tellanyl] acetate?
The canonical SMILES for [acetyloxy-(cyclopentylmethyl)-naphthalen-2-yl-λ4-tellanyl] acetate is CC(=O)O[Te](CC1CCCC1)(OC(C)=O)c1ccc2ccccc2c1.
What is the InChIKey of [acetyloxy-(cyclopentylmethyl)-naphthalen-2-yl-λ4-tellanyl] acetate?
The InChIKey is PFRYDNKZZRWNMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24O4Te/c1-15(21)23-25(24-16(2)22,14-17-7-3-4-8-17)20-12-11-18-9-5-6-10-19(18)13-20/h5-6,9-13,17H,3-4,7-8,14H2,1-2H3.
What are the key properties of [acetyloxy-(cyclopentylmethyl)-naphthalen-2-yl-λ4-tellanyl] acetate?
[acetyloxy-(cyclopentylmethyl)-naphthalen-2-yl-λ4-tellanyl] acetate has a molecular weight of 456.01 g/mol, XLogP of 3.81, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [acetyloxy-(cyclopentylmethyl)-naphthalen-2-yl-λ4-tellanyl] acetate is sourced from PubChem (CID 139265651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).