C18H30OSi — CID 139265898
[(E)-[(3aR,5aR,9bS)-5a,9-dimethyl-4,5,6,7,8,9b-hexahydro-3aH-benzo[g][1]benzofuran-3-ylidene]methyl]-trimethylsilane (PubChem CID 139265898) has the molecular formula C18H30OSi and a molecular weight of 290.52 g/mol. Its IUPAC name is [(E)-[(3aR,5aR,9bS)-5a,9-dimethyl-4,5,6,7,8,9b-hexahydro-3aH-benzo[g][1]benzofuran-3-ylidene]methyl]-trimethylsilane.
| Compound Name | [(E)-[(3aR,5aR,9bS)-5a,9-dimethyl-4,5,6,7,8,9b-hexahydro-3aH-benzo[g][1]benzofuran-3-ylidene]methyl]-trimethylsilane |
|---|---|
| PubChem CID | 139265898 |
| Molecular Formula | C18H30OSi |
| Molecular Weight | 290.52 g/mol |
| Exact Mass | 290.21 |
| IUPAC Name | [(E)-[(3aR,5aR,9bS)-5a,9-dimethyl-4,5,6,7,8,9b-hexahydro-3aH-benzo[g][1]benzofuran-3-ylidene]methyl]-trimethylsilane |
| SMILES | CC1=C2[C@H]3OC/C(=C/[Si](C)(C)C)[C@H]3CC[C@@]2(C)CCC1 |
| InChI | InChI=1S/C18H30OSi/c1-13-7-6-9-18(2)10-8-15-14(12-20(3,4)5)11-19-17(15)16(13)18/h12,15,17H,6-11H2,1-5H3/b14-12-/t15-,17+,18-/m1/s1 |
| InChIKey | WVALKQDZJJFXEW-CKIOFPDXSA-N |
| XLogP | 5.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.52 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|