C11H15NO2 — CID 139266068
methyl N-cyclohex-2-en-1-yl-N-prop-2-ynylcarbamate (PubChem CID 139266068) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is methyl N-cyclohex-2-en-1-yl-N-prop-2-ynylcarbamate.
| Compound Name | methyl N-cyclohex-2-en-1-yl-N-prop-2-ynylcarbamate |
|---|---|
| PubChem CID | 139266068 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | methyl N-cyclohex-2-en-1-yl-N-prop-2-ynylcarbamate |
| SMILES | C#CCN(C(=O)OC)C1C=CCCC1 |
| InChI | InChI=1S/C11H15NO2/c1-3-9-12(11(13)14-2)10-7-5-4-6-8-10/h1,5,7,10H,4,6,8-9H2,2H3 |
| InChIKey | QZZPNINSTJVKFW-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|