C17H20ClF3OSe — CID 139266189
3-chloro-10,10-dimethyl-3-[4-(trifluoromethyl)phenyl]-4-oxa-3λ4-selenatricyclo[5.2.1.01,5]decane (PubChem CID 139266189) has the molecular formula C17H20ClF3OSe and a molecular weight of 411.75 g/mol. Its IUPAC name is 3-chloro-10,10-dimethyl-3-[4-(trifluoromethyl)phenyl]-4-oxa-3λ4-selenatricyclo[5.2.1.01,5]decane.
| Compound Name | 3-chloro-10,10-dimethyl-3-[4-(trifluoromethyl)phenyl]-4-oxa-3λ4-selenatricyclo[5.2.1.01,5]decane |
|---|---|
| PubChem CID | 139266189 |
| Molecular Formula | C17H20ClF3OSe |
| Molecular Weight | 411.75 g/mol |
| Exact Mass | 412.03 |
| IUPAC Name | 3-chloro-10,10-dimethyl-3-[4-(trifluoromethyl)phenyl]-4-oxa-3λ4-selenatricyclo[5.2.1.01,5]decane |
| SMILES | CC1(C)C2CCC13C[Se](Cl)(c1ccc(C(F)(F)F)cc1)OC3C2 |
| InChI | InChI=1S/C17H20ClF3OSe/c1-15(2)12-7-8-16(15)10-23(18,22-14(16)9-12)13-5-3-11(4-6-13)17(19,20)21/h3-6,12,14H,7-10H2,1-2H3 |
| InChIKey | FJNCGVDASSUADS-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.75 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|