C17H21F3O4SSe — CID 139266200
(10,10-dimethyl-3-phenyl-4-oxa-3λ4-selenatricyclo[5.2.1.01,5]decan-3-yl) trifluoromethanesulfonate (PubChem CID 139266200) has the molecular formula C17H21F3O4SSe and a molecular weight of 457.37 g/mol. Its IUPAC name is (10,10-dimethyl-3-phenyl-4-oxa-3λ4-selenatricyclo[5.2.1.01,5]decan-3-yl) trifluoromethanesulfonate.
| Compound Name | (10,10-dimethyl-3-phenyl-4-oxa-3λ4-selenatricyclo[5.2.1.01,5]decan-3-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 139266200 |
| Molecular Formula | C17H21F3O4SSe |
| Molecular Weight | 457.37 g/mol |
| Exact Mass | 458.03 |
| IUPAC Name | (10,10-dimethyl-3-phenyl-4-oxa-3λ4-selenatricyclo[5.2.1.01,5]decan-3-yl) trifluoromethanesulfonate |
| SMILES | CC1(C)C2CCC13C[Se](OS(=O)(=O)C(F)(F)F)(c1ccccc1)OC3C2 |
| InChI | InChI=1S/C17H21F3O4SSe/c1-15(2)12-8-9-16(15)11-26(23-14(16)10-12,13-6-4-3-5-7-13)24-25(21,22)17(18,19)20/h3-7,12,14H,8-11H2,1-2H3 |
| InChIKey | UKCIYZRMIRZKSK-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.37 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|