About methanamine;phenyltellanylbenzene
methanamine;phenyltellanylbenzene (PubChem CID 139266253) has the molecular formula C14H20N2Te
and a molecular weight of 343.93 g/mol. Its IUPAC name is methanamine;phenyltellanylbenzene.
Molecular Properties
| Compound Name | methanamine;phenyltellanylbenzene |
| PubChem CID | 139266253 |
| Molecular Formula | C14H20N2Te |
| Molecular Weight | 343.93 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | methanamine;phenyltellanylbenzene |
| SMILES | CN.CN.c1ccc([Te]c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10Te.2CH5N/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;2*1-2/h1-10H;2*2H2,1H3 |
| InChIKey | MMUFPEXXBOJION-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.93 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze methanamine;phenyltellanylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanamine;phenyltellanylbenzene?
The IUPAC name of methanamine;phenyltellanylbenzene (CID 139266253) is methanamine;phenyltellanylbenzene.
What is the SMILES notation for methanamine;phenyltellanylbenzene?
The canonical SMILES for methanamine;phenyltellanylbenzene is CN.CN.c1ccc([Te]c2ccccc2)cc1.
What is the InChIKey of methanamine;phenyltellanylbenzene?
The InChIKey is MMUFPEXXBOJION-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10Te.2CH5N/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;2*1-2/h1-10H;2*2H2,1H3.
What are the key properties of methanamine;phenyltellanylbenzene?
methanamine;phenyltellanylbenzene has a molecular weight of 343.93 g/mol, XLogP of 0.49, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methanamine;phenyltellanylbenzene is sourced from PubChem (CID 139266253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).