About (2,6-dibenzoylselenan-2-yl) 4-chlorobenzoate
(2,6-dibenzoylselenan-2-yl) 4-chlorobenzoate (PubChem CID 139266539) has the molecular formula C26H21ClO4Se
and a molecular weight of 511.86 g/mol. Its IUPAC name is (2,6-dibenzoylselenan-2-yl) 4-chlorobenzoate.
Molecular Properties
| Compound Name | (2,6-dibenzoylselenan-2-yl) 4-chlorobenzoate |
| PubChem CID | 139266539 |
| Molecular Formula | C26H21ClO4Se |
| Molecular Weight | 511.86 g/mol |
| Exact Mass | 512.03 |
| IUPAC Name | (2,6-dibenzoylselenan-2-yl) 4-chlorobenzoate |
| SMILES | O=C(OC1(C(=O)c2ccccc2)CCCC(C(=O)c2ccccc2)[Se]1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H21ClO4Se/c27-21-15-13-20(14-16-21)25(30)31-26(24(29)19-10-5-2-6-11-19)17-7-12-22(32-26)23(28)18-8-3-1-4-9-18/h1-6,8-11,13-16,22H,7,12,17H2 |
| InChIKey | BWNQIWCGAQMVNX-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 511.86 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (2,6-dibenzoylselenan-2-yl) 4-chlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,6-dibenzoylselenan-2-yl) 4-chlorobenzoate?
The IUPAC name of (2,6-dibenzoylselenan-2-yl) 4-chlorobenzoate (CID 139266539) is (2,6-dibenzoylselenan-2-yl) 4-chlorobenzoate.
What is the SMILES notation for (2,6-dibenzoylselenan-2-yl) 4-chlorobenzoate?
The canonical SMILES for (2,6-dibenzoylselenan-2-yl) 4-chlorobenzoate is O=C(OC1(C(=O)c2ccccc2)CCCC(C(=O)c2ccccc2)[Se]1)c1ccc(Cl)cc1.
What is the InChIKey of (2,6-dibenzoylselenan-2-yl) 4-chlorobenzoate?
The InChIKey is BWNQIWCGAQMVNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H21ClO4Se/c27-21-15-13-20(14-16-21)25(30)31-26(24(29)19-10-5-2-6-11-19)17-7-12-22(32-26)23(28)18-8-3-1-4-9-18/h1-6,8-11,13-16,22H,7,12,17H2.
What are the key properties of (2,6-dibenzoylselenan-2-yl) 4-chlorobenzoate?
(2,6-dibenzoylselenan-2-yl) 4-chlorobenzoate has a molecular weight of 511.86 g/mol, XLogP of 5.64, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,6-dibenzoylselenan-2-yl) 4-chlorobenzoate is sourced from PubChem (CID 139266539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).