C16H22O5 — CID 139266600
methyl (E,2S)-2-hydroxy-8-phenylmethoxyoct-3-eneperoxoate (PubChem CID 139266600) has the molecular formula C16H22O5 and a molecular weight of 294.35 g/mol. Its IUPAC name is methyl (E,2S)-2-hydroxy-8-phenylmethoxyoct-3-eneperoxoate.
| Compound Name | methyl (E,2S)-2-hydroxy-8-phenylmethoxyoct-3-eneperoxoate |
|---|---|
| PubChem CID | 139266600 |
| Molecular Formula | C16H22O5 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | methyl (E,2S)-2-hydroxy-8-phenylmethoxyoct-3-eneperoxoate |
| SMILES | COOC(=O)[C@@H](O)/C=C/CCCCOCc1ccccc1 |
| InChI | InChI=1S/C16H22O5/c1-19-21-16(18)15(17)11-7-2-3-8-12-20-13-14-9-5-4-6-10-14/h4-7,9-11,15,17H,2-3,8,12-13H2,1H3/b11-7+/t15-/m0/s1 |
| InChIKey | IKGWLRCJMFNXDC-USYSOWRXSA-N |
| XLogP | 2.40 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|