About decylseleninyl decane-1-seleninate
decylseleninyl decane-1-seleninate (PubChem CID 139266679) has the molecular formula C20H42O3Se2
and a molecular weight of 488.47 g/mol. Its IUPAC name is decylseleninyl decane-1-seleninate.
Molecular Properties
| Compound Name | decylseleninyl decane-1-seleninate |
| PubChem CID | 139266679 |
| Molecular Formula | C20H42O3Se2 |
| Molecular Weight | 488.47 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | decylseleninyl decane-1-seleninate |
| SMILES | CCCCCCCCCC[Se](=O)O[Se](=O)CCCCCCCCCC |
| InChI | InChI=1S/C20H42O3Se2/c1-3-5-7-9-11-13-15-17-19-24(21)23-25(22)20-18-16-14-12-10-8-6-4-2/h3-20H2,1-2H3 |
| InChIKey | XMQCQZNFEPEXIJ-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 488.47 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze decylseleninyl decane-1-seleninate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decylseleninyl decane-1-seleninate?
The IUPAC name of decylseleninyl decane-1-seleninate (CID 139266679) is decylseleninyl decane-1-seleninate.
What is the SMILES notation for decylseleninyl decane-1-seleninate?
The canonical SMILES for decylseleninyl decane-1-seleninate is CCCCCCCCCC[Se](=O)O[Se](=O)CCCCCCCCCC.
What is the InChIKey of decylseleninyl decane-1-seleninate?
The InChIKey is XMQCQZNFEPEXIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H42O3Se2/c1-3-5-7-9-11-13-15-17-19-24(21)23-25(22)20-18-16-14-12-10-8-6-4-2/h3-20H2,1-2H3.
What are the key properties of decylseleninyl decane-1-seleninate?
decylseleninyl decane-1-seleninate has a molecular weight of 488.47 g/mol, XLogP of 7.12, 20 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for decylseleninyl decane-1-seleninate is sourced from PubChem (CID 139266679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).