C43H74O9 — CID 139266820
(4E,18E)-7,9,11-trihydroxy-6'-(3-hydroxypentan-2-yl)-5',6,8,12,27-pentamethyl-20-(2-methylpropyl)spiro[2,24-dioxabicyclo[21.3.1]heptacosa-4,18-diene-25,2'-oxane]-3,21-dione (PubChem CID 139266820) has the molecular formula C43H74O9 and a molecular weight of 735.06 g/mol. Its IUPAC name is (4E,18E)-7,9,11-trihydroxy-6'-(3-hydroxypentan-2-yl)-5',6,8,12,27-pentamethyl-20-(2-methylpropyl)spiro[2,24-dioxabicyclo[21.3.1]heptacosa-4,18-diene-25,2'-oxane]-3,21-dione.
| Compound Name | (4E,18E)-7,9,11-trihydroxy-6'-(3-hydroxypentan-2-yl)-5',6,8,12,27-pentamethyl-20-(2-methylpropyl)spiro[2,24-dioxabicyclo[21.3.1]heptacosa-4,18-diene-25,2'-oxane]-3,21-dione |
|---|---|
| PubChem CID | 139266820 |
| Molecular Formula | C43H74O9 |
| Molecular Weight | 735.06 g/mol |
| Exact Mass | 734.53 |
| IUPAC Name | (4E,18E)-7,9,11-trihydroxy-6'-(3-hydroxypentan-2-yl)-5',6,8,12,27-pentamethyl-20-(2-methylpropyl)spiro[2,24-dioxabicyclo[21.3.1]heptacosa-4,18-diene-25,2'-oxane]-3,21-dione |
| SMILES | CCC(O)C(C)C1OC2(CCC1C)CC1OC(=O)/C=C/C(C)C(O)C(C)C(O)CC(O)C(C)CCCCC/C=C/C(CC(C)C)C(=O)CC(O2)C1C |
| InChI | InChI=1S/C43H74O9/c1-10-34(44)31(8)42-29(6)20-21-43(52-42)25-39-32(9)38(51-43)24-37(47)33(22-26(2)3)17-15-13-11-12-14-16-27(4)35(45)23-36(46)30(7)41(49)28(5)18-19-40(48)50-39/h15,17-19,26-36,38-39,41-42,44-46,49H,10-14,16,20-25H2,1-9H3/b17-15+,19-18+ |
| InChIKey | IMEHZFINIZSULO-CBNHHMLQSA-N |
| XLogP | 7.32 |
| TPSA | 142.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.06 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|