About 1-[3-(3,4-dihydro-2H-pyran-2-yl)oxiran-2-yl]but-3-en-1-one
1-[3-(3,4-dihydro-2H-pyran-2-yl)oxiran-2-yl]but-3-en-1-one (PubChem CID 139266882) has the molecular formula C11H14O3
and a molecular weight of 194.23 g/mol. Its IUPAC name is 1-[3-(3,4-dihydro-2H-pyran-2-yl)oxiran-2-yl]but-3-en-1-one.
Molecular Properties
| Compound Name | 1-[3-(3,4-dihydro-2H-pyran-2-yl)oxiran-2-yl]but-3-en-1-one |
| PubChem CID | 139266882 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 1-[3-(3,4-dihydro-2H-pyran-2-yl)oxiran-2-yl]but-3-en-1-one |
| SMILES | C=CCC(=O)C1OC1C1CCC=CO1 |
| InChI | InChI=1S/C11H14O3/c1-2-5-8(12)10-11(14-10)9-6-3-4-7-13-9/h2,4,7,9-11H,1,3,5-6H2 |
| InChIKey | UDVLENVFXQTCTC-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1-[3-(3,4-dihydro-2H-pyran-2-yl)oxiran-2-yl]but-3-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(3,4-dihydro-2H-pyran-2-yl)oxiran-2-yl]but-3-en-1-one?
The IUPAC name of 1-[3-(3,4-dihydro-2H-pyran-2-yl)oxiran-2-yl]but-3-en-1-one (CID 139266882) is 1-[3-(3,4-dihydro-2H-pyran-2-yl)oxiran-2-yl]but-3-en-1-one.
What is the SMILES notation for 1-[3-(3,4-dihydro-2H-pyran-2-yl)oxiran-2-yl]but-3-en-1-one?
The canonical SMILES for 1-[3-(3,4-dihydro-2H-pyran-2-yl)oxiran-2-yl]but-3-en-1-one is C=CCC(=O)C1OC1C1CCC=CO1.
What is the InChIKey of 1-[3-(3,4-dihydro-2H-pyran-2-yl)oxiran-2-yl]but-3-en-1-one?
The InChIKey is UDVLENVFXQTCTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O3/c1-2-5-8(12)10-11(14-10)9-6-3-4-7-13-9/h2,4,7,9-11H,1,3,5-6H2.
What are the key properties of 1-[3-(3,4-dihydro-2H-pyran-2-yl)oxiran-2-yl]but-3-en-1-one?
1-[3-(3,4-dihydro-2H-pyran-2-yl)oxiran-2-yl]but-3-en-1-one has a molecular weight of 194.23 g/mol, XLogP of 1.59, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(3,4-dihydro-2H-pyran-2-yl)oxiran-2-yl]but-3-en-1-one is sourced from PubChem (CID 139266882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).