C16H17NO4 — CID 139267086
methyl 6-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)hexa-2,3-dienoate (PubChem CID 139267086) has the molecular formula C16H17NO4 and a molecular weight of 287.31 g/mol. Its IUPAC name is methyl 6-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)hexa-2,3-dienoate.
| Compound Name | methyl 6-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)hexa-2,3-dienoate |
|---|---|
| PubChem CID | 139267086 |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | methyl 6-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)hexa-2,3-dienoate |
| SMILES | COC(=O)C=C=CCCN1C(=O)C2C3C=CC(C3)C2C1=O |
| InChI | InChI=1S/C16H17NO4/c1-21-12(18)5-3-2-4-8-17-15(19)13-10-6-7-11(9-10)14(13)16(17)20/h2,5-7,10-11,13-14H,4,8-9H2,1H3 |
| InChIKey | LCDIUJFUWKAZGE-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|