C17H19NO4 — CID 139267135
methyl 7-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)hepta-2,3-dienoate (PubChem CID 139267135) has the molecular formula C17H19NO4 and a molecular weight of 301.34 g/mol. Its IUPAC name is methyl 7-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)hepta-2,3-dienoate.
| Compound Name | methyl 7-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)hepta-2,3-dienoate |
|---|---|
| PubChem CID | 139267135 |
| Molecular Formula | C17H19NO4 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | methyl 7-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)hepta-2,3-dienoate |
| SMILES | COC(=O)C=C=CCCCN1C(=O)C2C3C=CC(C3)C2C1=O |
| InChI | InChI=1S/C17H19NO4/c1-22-13(19)6-4-2-3-5-9-18-16(20)14-11-7-8-12(10-11)15(14)17(18)21/h2,6-8,11-12,14-15H,3,5,9-10H2,1H3 |
| InChIKey | OTYXSEQVVYIYEV-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|