C18H21NO4 — CID 139267169
methyl 8-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)octa-2,3-dienoate (PubChem CID 139267169) has the molecular formula C18H21NO4 and a molecular weight of 315.37 g/mol. Its IUPAC name is methyl 8-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)octa-2,3-dienoate.
| Compound Name | methyl 8-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)octa-2,3-dienoate |
|---|---|
| PubChem CID | 139267169 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | methyl 8-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)octa-2,3-dienoate |
| SMILES | COC(=O)C=C=CCCCCN1C(=O)C2C3C=CC(C3)C2C1=O |
| InChI | InChI=1S/C18H21NO4/c1-23-14(20)7-5-3-2-4-6-10-19-17(21)15-12-8-9-13(11-12)16(15)18(19)22/h3,7-9,12-13,15-16H,2,4,6,10-11H2,1H3 |
| InChIKey | BEGQUQJVQJKJJX-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|