C16H14N6O — CID 139267186
2-[5-[4-(2H-tetrazol-5-yl)phenyl]-4,5-dihydro-1H-pyrazol-3-yl]phenol (PubChem CID 139267186) has the molecular formula C16H14N6O and a molecular weight of 306.33 g/mol. Its IUPAC name is 2-[5-[4-(2H-tetrazol-5-yl)phenyl]-4,5-dihydro-1H-pyrazol-3-yl]phenol.
| Compound Name | 2-[5-[4-(2H-tetrazol-5-yl)phenyl]-4,5-dihydro-1H-pyrazol-3-yl]phenol |
|---|---|
| PubChem CID | 139267186 |
| Molecular Formula | C16H14N6O |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 2-[5-[4-(2H-tetrazol-5-yl)phenyl]-4,5-dihydro-1H-pyrazol-3-yl]phenol |
| SMILES | Oc1ccccc1C1=NNC(c2ccc(-c3nn[nH]n3)cc2)C1 |
| InChI | InChI=1S/C16H14N6O/c23-15-4-2-1-3-12(15)14-9-13(17-18-14)10-5-7-11(8-6-10)16-19-21-22-20-16/h1-8,13,17,23H,9H2,(H,19,20,21,22) |
| InChIKey | GFBPRRHRFQAVLH-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'} |
|---|