C20H16FNO4 — CID 139267273
ethyl 2-acetamido-5-[3-(4-fluorophenyl)-3-oxoprop-1-ynyl]benzoate (PubChem CID 139267273) has the molecular formula C20H16FNO4 and a molecular weight of 353.35 g/mol. Its IUPAC name is ethyl 2-acetamido-5-[3-(4-fluorophenyl)-3-oxoprop-1-ynyl]benzoate.
| Compound Name | ethyl 2-acetamido-5-[3-(4-fluorophenyl)-3-oxoprop-1-ynyl]benzoate |
|---|---|
| PubChem CID | 139267273 |
| Molecular Formula | C20H16FNO4 |
| Molecular Weight | 353.35 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | ethyl 2-acetamido-5-[3-(4-fluorophenyl)-3-oxoprop-1-ynyl]benzoate |
| SMILES | CCOC(=O)c1cc(C#CC(=O)c2ccc(F)cc2)ccc1NC(C)=O |
| InChI | InChI=1S/C20H16FNO4/c1-3-26-20(25)17-12-14(4-10-18(17)22-13(2)23)5-11-19(24)15-6-8-16(21)9-7-15/h4,6-10,12H,3H2,1-2H3,(H,22,23) |
| InChIKey | LBDRSLGFUZZAPB-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.35 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|