C28H16N4O2 — CID 139267554
4-[1-(3,4-dicyanophenoxy)-4-phenylcyclohexa-2,4-dien-1-yl]oxybenzene-1,2-dicarbonitrile (PubChem CID 139267554) has the molecular formula C28H16N4O2 and a molecular weight of 440.46 g/mol. Its IUPAC name is 4-[1-(3,4-dicyanophenoxy)-4-phenylcyclohexa-2,4-dien-1-yl]oxybenzene-1,2-dicarbonitrile.
| Compound Name | 4-[1-(3,4-dicyanophenoxy)-4-phenylcyclohexa-2,4-dien-1-yl]oxybenzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 139267554 |
| Molecular Formula | C28H16N4O2 |
| Molecular Weight | 440.46 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | 4-[1-(3,4-dicyanophenoxy)-4-phenylcyclohexa-2,4-dien-1-yl]oxybenzene-1,2-dicarbonitrile |
| SMILES | N#Cc1ccc(OC2(Oc3ccc(C#N)c(C#N)c3)C=CC(c3ccccc3)=CC2)cc1C#N |
| InChI | InChI=1S/C28H16N4O2/c29-16-22-6-8-26(14-24(22)18-31)33-28(34-27-9-7-23(17-30)25(15-27)19-32)12-10-21(11-13-28)20-4-2-1-3-5-20/h1-12,14-15H,13H2 |
| InChIKey | ZPLOOOOXLIVSNB-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 113.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.46 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|