C30H21N3O2S — CID 139267604
3-amino-4-(furan-2-yl)-N,N,6-triphenylthieno[2,3-b]pyridine-2-carboxamide (PubChem CID 139267604) has the molecular formula C30H21N3O2S and a molecular weight of 487.58 g/mol. Its IUPAC name is 3-amino-4-(furan-2-yl)-N,N,6-triphenylthieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 3-amino-4-(furan-2-yl)-N,N,6-triphenylthieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 139267604 |
| Molecular Formula | C30H21N3O2S |
| Molecular Weight | 487.58 g/mol |
| Exact Mass | 487.14 |
| IUPAC Name | 3-amino-4-(furan-2-yl)-N,N,6-triphenylthieno[2,3-b]pyridine-2-carboxamide |
| SMILES | Nc1c(C(=O)N(c2ccccc2)c2ccccc2)sc2nc(-c3ccccc3)cc(-c3ccco3)c12 |
| InChI | InChI=1S/C30H21N3O2S/c31-27-26-23(25-17-10-18-35-25)19-24(20-11-4-1-5-12-20)32-29(26)36-28(27)30(34)33(21-13-6-2-7-14-21)22-15-8-3-9-16-22/h1-19H,31H2 |
| InChIKey | FJAOLFHKVUHMHA-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.58 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |