C16H21ClFN3O2 — CID 139267758
(3S)-3-N-(4-chloro-3-fluorophenyl)-1-N-propylpiperidine-1,3-dicarboxamide (PubChem CID 139267758) has the molecular formula C16H21ClFN3O2 and a molecular weight of 341.81 g/mol. Its IUPAC name is (3S)-3-N-(4-chloro-3-fluorophenyl)-1-N-propylpiperidine-1,3-dicarboxamide.
| Compound Name | (3S)-3-N-(4-chloro-3-fluorophenyl)-1-N-propylpiperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 139267758 |
| Molecular Formula | C16H21ClFN3O2 |
| Molecular Weight | 341.81 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | (3S)-3-N-(4-chloro-3-fluorophenyl)-1-N-propylpiperidine-1,3-dicarboxamide |
| SMILES | CCCNC(=O)N1CCC[C@H](C(=O)Nc2ccc(Cl)c(F)c2)C1 |
| InChI | InChI=1S/C16H21ClFN3O2/c1-2-7-19-16(23)21-8-3-4-11(10-21)15(22)20-12-5-6-13(17)14(18)9-12/h5-6,9,11H,2-4,7-8,10H2,1H3,(H,19,23)(H,20,22)/t11-/m0/s1 |
| InChIKey | YXSFKFUFRNSJGC-NSHDSACASA-N |
| XLogP | 3.25 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.81 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |