C19H27NO4 — CID 139267795
4-[[phenylmethoxycarbonyl(propan-2-yl)amino]methyl]cyclohexane-1-carboxylic acid (PubChem CID 139267795) has the molecular formula C19H27NO4 and a molecular weight of 333.43 g/mol. Its IUPAC name is 4-[[phenylmethoxycarbonyl(propan-2-yl)amino]methyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[phenylmethoxycarbonyl(propan-2-yl)amino]methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 139267795 |
| Molecular Formula | C19H27NO4 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | 4-[[phenylmethoxycarbonyl(propan-2-yl)amino]methyl]cyclohexane-1-carboxylic acid |
| SMILES | CC(C)N(CC1CCC(C(=O)O)CC1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H27NO4/c1-14(2)20(12-15-8-10-17(11-9-15)18(21)22)19(23)24-13-16-6-4-3-5-7-16/h3-7,14-15,17H,8-13H2,1-2H3,(H,21,22) |
| InChIKey | YYULWWXBCVUPGQ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |