C21H24F3N6O3- — CID 139268490
N-[(1R)-2,2-dimethyl-1-[3-(oxidoamino)-4-(trifluoromethyl)phenyl]propyl]-6-oxo-2-pyrimidin-2-yl-1,3-diazinane-4-carboxamide (PubChem CID 139268490) has the molecular formula C21H24F3N6O3- and a molecular weight of 465.46 g/mol. Its IUPAC name is N-[(1R)-2,2-dimethyl-1-[3-(oxidoamino)-4-(trifluoromethyl)phenyl]propyl]-6-oxo-2-pyrimidin-2-yl-1,3-diazinane-4-carboxamide.
| Compound Name | N-[(1R)-2,2-dimethyl-1-[3-(oxidoamino)-4-(trifluoromethyl)phenyl]propyl]-6-oxo-2-pyrimidin-2-yl-1,3-diazinane-4-carboxamide |
|---|---|
| PubChem CID | 139268490 |
| Molecular Formula | C21H24F3N6O3- |
| Molecular Weight | 465.46 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | N-[(1R)-2,2-dimethyl-1-[3-(oxidoamino)-4-(trifluoromethyl)phenyl]propyl]-6-oxo-2-pyrimidin-2-yl-1,3-diazinane-4-carboxamide |
| SMILES | CC(C)(C)[C@@H](NC(=O)C1CC(=O)NC(c2ncccn2)N1)c1ccc(C(F)(F)F)c(N[O-])c1 |
| InChI | InChI=1S/C21H24F3N6O3/c1-20(2,3)16(11-5-6-12(21(22,23)24)13(9-11)30-33)29-19(32)14-10-15(31)28-18(27-14)17-25-7-4-8-26-17/h4-9,14,16,18,27,30H,10H2,1-3H3,(H,28,31)(H,29,32)/q-1/t14?,16-,18?/m0/s1 |
| InChIKey | GTMYYCAABRKATH-HQVVEAJESA-N |
| XLogP | 2.79 |
| TPSA | 131.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.46 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|