C31H25ClF2N6O2 — CID 139268671
14-[5-[3-chloro-2-fluoro-6-(tetrazol-1-yl)phenyl]-1-oxidopyridin-1-ium-2-yl]-4-fluoro-10-methyl-8-azatricyclo[13.3.1.02,7]nonadeca-1(19),2(7),3,5,15,17-hexaen-9-one (PubChem CID 139268671) has the molecular formula C31H25ClF2N6O2 and a molecular weight of 587.03 g/mol. Its IUPAC name is 14-[5-[3-chloro-2-fluoro-6-(tetrazol-1-yl)phenyl]-1-oxidopyridin-1-ium-2-yl]-4-fluoro-10-methyl-8-azatricyclo[13.3.1.02,7]nonadeca-1(19),2(7),3,5,15,17-hexaen-9-one.
| Compound Name | 14-[5-[3-chloro-2-fluoro-6-(tetrazol-1-yl)phenyl]-1-oxidopyridin-1-ium-2-yl]-4-fluoro-10-methyl-8-azatricyclo[13.3.1.02,7]nonadeca-1(19),2(7),3,5,15,17-hexaen-9-one |
|---|---|
| PubChem CID | 139268671 |
| Molecular Formula | C31H25ClF2N6O2 |
| Molecular Weight | 587.03 g/mol |
| Exact Mass | 586.17 |
| IUPAC Name | 14-[5-[3-chloro-2-fluoro-6-(tetrazol-1-yl)phenyl]-1-oxidopyridin-1-ium-2-yl]-4-fluoro-10-methyl-8-azatricyclo[13.3.1.02,7]nonadeca-1(19),2(7),3,5,15,17-hexaen-9-one |
| SMILES | CC1CCCC(c2ccc(-c3c(-n4cnnn4)ccc(Cl)c3F)c[n+]2[O-])c2cccc(c2)-c2cc(F)ccc2NC1=O |
| InChI | InChI=1S/C31H25ClF2N6O2/c1-18-4-2-7-23(19-5-3-6-20(14-19)24-15-22(33)9-11-26(24)36-31(18)41)27-12-8-21(16-40(27)42)29-28(39-17-35-37-38-39)13-10-25(32)30(29)34/h3,5-6,8-18,23H,2,4,7H2,1H3,(H,36,41) |
| InChIKey | YFXJVNCSNTUTEC-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 99.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.03 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|