C27H22ClFN8O2 — CID 139268674
14-[5-[5-chloro-2-(tetrazol-1-yl)phenyl]-1-oxidopyridin-1-ium-2-yl]-4-fluoro-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15-pentaen-9-one (PubChem CID 139268674) has the molecular formula C27H22ClFN8O2 and a molecular weight of 544.98 g/mol. Its IUPAC name is 14-[5-[5-chloro-2-(tetrazol-1-yl)phenyl]-1-oxidopyridin-1-ium-2-yl]-4-fluoro-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15-pentaen-9-one.
| Compound Name | 14-[5-[5-chloro-2-(tetrazol-1-yl)phenyl]-1-oxidopyridin-1-ium-2-yl]-4-fluoro-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15-pentaen-9-one |
|---|---|
| PubChem CID | 139268674 |
| Molecular Formula | C27H22ClFN8O2 |
| Molecular Weight | 544.98 g/mol |
| Exact Mass | 544.15 |
| IUPAC Name | 14-[5-[5-chloro-2-(tetrazol-1-yl)phenyl]-1-oxidopyridin-1-ium-2-yl]-4-fluoro-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15-pentaen-9-one |
| SMILES | O=C1CCCCC(c2ccc(-c3cc(Cl)ccc3-n3cnnn3)c[n+]2[O-])c2ncc([nH]2)-c2cc(F)ccc2N1 |
| InChI | InChI=1S/C27H22ClFN8O2/c28-17-6-10-24(36-15-31-34-35-36)20(11-17)16-5-9-25(37(39)14-16)19-3-1-2-4-26(38)32-22-8-7-18(29)12-21(22)23-13-30-27(19)33-23/h5-15,19H,1-4H2,(H,30,33)(H,32,38) |
| InChIKey | MKAAOSLIXYNBND-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 128.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.98 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|