C27H22ClFN8O3 — CID 139268788
14-[5-[5-chloro-2-(tetrazol-1-yl)phenyl]-1-oxidopyridin-1-ium-2-yl]-4-fluoro-14-hydroxy-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15-pentaen-9-one (PubChem CID 139268788) has the molecular formula C27H22ClFN8O3 and a molecular weight of 560.98 g/mol. Its IUPAC name is 14-[5-[5-chloro-2-(tetrazol-1-yl)phenyl]-1-oxidopyridin-1-ium-2-yl]-4-fluoro-14-hydroxy-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15-pentaen-9-one.
| Compound Name | 14-[5-[5-chloro-2-(tetrazol-1-yl)phenyl]-1-oxidopyridin-1-ium-2-yl]-4-fluoro-14-hydroxy-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15-pentaen-9-one |
|---|---|
| PubChem CID | 139268788 |
| Molecular Formula | C27H22ClFN8O3 |
| Molecular Weight | 560.98 g/mol |
| Exact Mass | 560.15 |
| IUPAC Name | 14-[5-[5-chloro-2-(tetrazol-1-yl)phenyl]-1-oxidopyridin-1-ium-2-yl]-4-fluoro-14-hydroxy-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15-pentaen-9-one |
| SMILES | O=C1CCCCC(O)(c2ccc(-c3cc(Cl)ccc3-n3cnnn3)c[n+]2[O-])c2ncc([nH]2)-c2cc(F)ccc2N1 |
| InChI | InChI=1S/C27H22ClFN8O3/c28-17-5-8-23(36-15-31-34-35-36)19(11-17)16-4-9-24(37(40)14-16)27(39)10-2-1-3-25(38)32-21-7-6-18(29)12-20(21)22-13-30-26(27)33-22/h4-9,11-15,39H,1-3,10H2,(H,30,33)(H,32,38) |
| InChIKey | ZXNOODSHPPDZQX-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 148.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.98 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|