C26H22ClF2N5O2 — CID 139268789
5-amino-14-[5-(3-chloro-2,6-difluorophenyl)-1-oxidopyridin-1-ium-2-yl]-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15-pentaen-9-one (PubChem CID 139268789) has the molecular formula C26H22ClF2N5O2 and a molecular weight of 509.94 g/mol. Its IUPAC name is 5-amino-14-[5-(3-chloro-2,6-difluorophenyl)-1-oxidopyridin-1-ium-2-yl]-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15-pentaen-9-one.
| Compound Name | 5-amino-14-[5-(3-chloro-2,6-difluorophenyl)-1-oxidopyridin-1-ium-2-yl]-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15-pentaen-9-one |
|---|---|
| PubChem CID | 139268789 |
| Molecular Formula | C26H22ClF2N5O2 |
| Molecular Weight | 509.94 g/mol |
| Exact Mass | 509.14 |
| IUPAC Name | 5-amino-14-[5-(3-chloro-2,6-difluorophenyl)-1-oxidopyridin-1-ium-2-yl]-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15-pentaen-9-one |
| SMILES | Nc1ccc2c(c1)NC(=O)CCCCC(c1ccc(-c3c(F)ccc(Cl)c3F)c[n+]1[O-])c1ncc-2[nH]1 |
| InChI | InChI=1S/C26H22ClF2N5O2/c27-18-8-9-19(28)24(25(18)29)14-5-10-22(34(36)13-14)17-3-1-2-4-23(35)32-20-11-15(30)6-7-16(20)21-12-31-26(17)33-21/h5-13,17H,1-4,30H2,(H,31,33)(H,32,35) |
| InChIKey | DWKQZTJLIGQXCW-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 110.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.94 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|