C30H28F3N5O4 — CID 139268805
methyl N-[(14R)-17-methyl-14-[1-oxido-5-[2-(trifluoromethyl)phenyl]pyridin-1-ium-2-yl]-9-oxo-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15(18)-pentaen-5-yl]carbamate (PubChem CID 139268805) has the molecular formula C30H28F3N5O4 and a molecular weight of 579.58 g/mol. Its IUPAC name is methyl N-[(14R)-17-methyl-14-[1-oxido-5-[2-(trifluoromethyl)phenyl]pyridin-1-ium-2-yl]-9-oxo-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15(18)-pentaen-5-yl]carbamate.
| Compound Name | methyl N-[(14R)-17-methyl-14-[1-oxido-5-[2-(trifluoromethyl)phenyl]pyridin-1-ium-2-yl]-9-oxo-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15(18)-pentaen-5-yl]carbamate |
|---|---|
| PubChem CID | 139268805 |
| Molecular Formula | C30H28F3N5O4 |
| Molecular Weight | 579.58 g/mol |
| Exact Mass | 579.21 |
| IUPAC Name | methyl N-[(14R)-17-methyl-14-[1-oxido-5-[2-(trifluoromethyl)phenyl]pyridin-1-ium-2-yl]-9-oxo-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15(18)-pentaen-5-yl]carbamate |
| SMILES | COC(=O)Nc1ccc2c(c1)NC(=O)CCCC[C@H](c1ccc(-c3ccccc3C(F)(F)F)c[n+]1[O-])c1nc-2c(C)[nH]1 |
| InChI | InChI=1S/C30H28F3N5O4/c1-17-27-21-13-12-19(35-29(40)42-2)15-24(21)36-26(39)10-6-4-8-22(28(34-17)37-27)25-14-11-18(16-38(25)41)20-7-3-5-9-23(20)30(31,32)33/h3,5,7,9,11-16,22H,4,6,8,10H2,1-2H3,(H,34,37)(H,35,40)(H,36,39)/t22-/m1/s1 |
| InChIKey | CHGFKSDZFXYHGV-JOCHJYFZSA-N |
| XLogP | 6.53 |
| TPSA | 123.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.58 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|