C30H27F4N5O4 — CID 139268806
methyl N-[(14R)-14-[5-[2-fluoro-6-(trifluoromethyl)phenyl]-1-oxidopyridin-1-ium-2-yl]-17-methyl-9-oxo-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15(18)-pentaen-5-yl]carbamate (PubChem CID 139268806) has the molecular formula C30H27F4N5O4 and a molecular weight of 597.57 g/mol. Its IUPAC name is methyl N-[(14R)-14-[5-[2-fluoro-6-(trifluoromethyl)phenyl]-1-oxidopyridin-1-ium-2-yl]-17-methyl-9-oxo-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15(18)-pentaen-5-yl]carbamate.
| Compound Name | methyl N-[(14R)-14-[5-[2-fluoro-6-(trifluoromethyl)phenyl]-1-oxidopyridin-1-ium-2-yl]-17-methyl-9-oxo-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15(18)-pentaen-5-yl]carbamate |
|---|---|
| PubChem CID | 139268806 |
| Molecular Formula | C30H27F4N5O4 |
| Molecular Weight | 597.57 g/mol |
| Exact Mass | 597.20 |
| IUPAC Name | methyl N-[(14R)-14-[5-[2-fluoro-6-(trifluoromethyl)phenyl]-1-oxidopyridin-1-ium-2-yl]-17-methyl-9-oxo-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15(18)-pentaen-5-yl]carbamate |
| SMILES | COC(=O)Nc1ccc2c(c1)NC(=O)CCCC[C@H](c1ccc(-c3c(F)cccc3C(F)(F)F)c[n+]1[O-])c1nc-2c(C)[nH]1 |
| InChI | InChI=1S/C30H27F4N5O4/c1-16-27-19-12-11-18(36-29(41)43-2)14-23(19)37-25(40)9-4-3-6-20(28(35-16)38-27)24-13-10-17(15-39(24)42)26-21(30(32,33)34)7-5-8-22(26)31/h5,7-8,10-15,20H,3-4,6,9H2,1-2H3,(H,35,38)(H,36,41)(H,37,40)/t20-/m1/s1 |
| InChIKey | PGSAHHBOACEADY-HXUWFJFHSA-N |
| XLogP | 6.67 |
| TPSA | 123.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.57 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|