C27H24ClF2N5O2 — CID 139268811
(14R)-5-amino-14-[5-(3-chloro-2,6-difluorophenyl)-1-oxidopyridin-1-ium-2-yl]-17-methyl-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15(18)-pentaen-9-one (PubChem CID 139268811) has the molecular formula C27H24ClF2N5O2 and a molecular weight of 523.97 g/mol. Its IUPAC name is (14R)-5-amino-14-[5-(3-chloro-2,6-difluorophenyl)-1-oxidopyridin-1-ium-2-yl]-17-methyl-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15(18)-pentaen-9-one.
| Compound Name | (14R)-5-amino-14-[5-(3-chloro-2,6-difluorophenyl)-1-oxidopyridin-1-ium-2-yl]-17-methyl-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15(18)-pentaen-9-one |
|---|---|
| PubChem CID | 139268811 |
| Molecular Formula | C27H24ClF2N5O2 |
| Molecular Weight | 523.97 g/mol |
| Exact Mass | 523.16 |
| IUPAC Name | (14R)-5-amino-14-[5-(3-chloro-2,6-difluorophenyl)-1-oxidopyridin-1-ium-2-yl]-17-methyl-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15(18)-pentaen-9-one |
| SMILES | Cc1[nH]c2nc1-c1ccc(N)cc1NC(=O)CCCC[C@@H]2c1ccc(-c2c(F)ccc(Cl)c2F)c[n+]1[O-] |
| InChI | InChI=1S/C27H24ClF2N5O2/c1-14-26-17-8-7-16(31)12-21(17)33-23(36)5-3-2-4-18(27(32-14)34-26)22-11-6-15(13-35(22)37)24-20(29)10-9-19(28)25(24)30/h6-13,18H,2-5,31H2,1H3,(H,32,34)(H,33,36)/t18-/m1/s1 |
| InChIKey | OLHHQMRNSGUPLQ-GOSISDBHSA-N |
| XLogP | 5.84 |
| TPSA | 110.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.97 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|