C28H23F5N4O2 — CID 139268880
(9R,13S)-3-(difluoromethyl)-9-methyl-13-[1-oxido-5-(2,3,6-trifluorophenyl)pyridin-1-ium-2-yl]-3,4,7-triazatricyclo[12.3.1.02,6]octadeca-1(18),2(6),4,14,16-pentaen-8-one (PubChem CID 139268880) has the molecular formula C28H23F5N4O2 and a molecular weight of 542.51 g/mol. Its IUPAC name is (9R,13S)-3-(difluoromethyl)-9-methyl-13-[1-oxido-5-(2,3,6-trifluorophenyl)pyridin-1-ium-2-yl]-3,4,7-triazatricyclo[12.3.1.02,6]octadeca-1(18),2(6),4,14,16-pentaen-8-one.
| Compound Name | (9R,13S)-3-(difluoromethyl)-9-methyl-13-[1-oxido-5-(2,3,6-trifluorophenyl)pyridin-1-ium-2-yl]-3,4,7-triazatricyclo[12.3.1.02,6]octadeca-1(18),2(6),4,14,16-pentaen-8-one |
|---|---|
| PubChem CID | 139268880 |
| Molecular Formula | C28H23F5N4O2 |
| Molecular Weight | 542.51 g/mol |
| Exact Mass | 542.17 |
| IUPAC Name | (9R,13S)-3-(difluoromethyl)-9-methyl-13-[1-oxido-5-(2,3,6-trifluorophenyl)pyridin-1-ium-2-yl]-3,4,7-triazatricyclo[12.3.1.02,6]octadeca-1(18),2(6),4,14,16-pentaen-8-one |
| SMILES | C[C@@H]1CCC[C@H](c2ccc(-c3c(F)ccc(F)c3F)c[n+]2[O-])c2cccc(c2)-c2c(cnn2C(F)F)NC1=O |
| InChI | InChI=1S/C28H23F5N4O2/c1-15-4-2-7-19(23-11-8-18(14-36(23)39)24-20(29)9-10-21(30)25(24)31)16-5-3-6-17(12-16)26-22(35-27(15)38)13-34-37(26)28(32)33/h3,5-6,8-15,19,28H,2,4,7H2,1H3,(H,35,38)/t15-,19+/m1/s1 |
| InChIKey | CPZNBIGUTPTQIQ-BEFAXECRSA-N |
| XLogP | 6.55 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.51 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|