C21H20N6O2 — CID 139268917
8-(1H-benzimidazol-2-ylmethyl)-7-benzyl-3-methyl-4,5-dihydropurine-2,6-dione (PubChem CID 139268917) has the molecular formula C21H20N6O2 and a molecular weight of 388.43 g/mol. Its IUPAC name is 8-(1H-benzimidazol-2-ylmethyl)-7-benzyl-3-methyl-4,5-dihydropurine-2,6-dione.
| Compound Name | 8-(1H-benzimidazol-2-ylmethyl)-7-benzyl-3-methyl-4,5-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 139268917 |
| Molecular Formula | C21H20N6O2 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 8-(1H-benzimidazol-2-ylmethyl)-7-benzyl-3-methyl-4,5-dihydropurine-2,6-dione |
| SMILES | CN1C(=O)NC(=O)C2C1N=C(Cc1nc3ccccc3[nH]1)N2Cc1ccccc1 |
| InChI | InChI=1S/C21H20N6O2/c1-26-19-18(20(28)25-21(26)29)27(12-13-7-3-2-4-8-13)17(24-19)11-16-22-14-9-5-6-10-15(14)23-16/h2-10,18-19H,11-12H2,1H3,(H,22,23)(H,25,28,29) |
| InChIKey | WXIZJTHORQJSRN-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 93.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |