C23H24F3N9O3S — CID 139269393
(2S)-N-[2-[2-(3-azabicyclo[3.1.0]hexan-3-yl)pyrimidin-5-yl]-1,3-thiazol-4-yl]-2-[3-methyl-2,6-dioxo-1-(2,2,2-trifluoroethyl)-4,5-dihydropurin-7-yl]propanamide (PubChem CID 139269393) has the molecular formula C23H24F3N9O3S and a molecular weight of 563.57 g/mol. Its IUPAC name is (2S)-N-[2-[2-(3-azabicyclo[3.1.0]hexan-3-yl)pyrimidin-5-yl]-1,3-thiazol-4-yl]-2-[3-methyl-2,6-dioxo-1-(2,2,2-trifluoroethyl)-4,5-dihydropurin-7-yl]propanamide.
| Compound Name | (2S)-N-[2-[2-(3-azabicyclo[3.1.0]hexan-3-yl)pyrimidin-5-yl]-1,3-thiazol-4-yl]-2-[3-methyl-2,6-dioxo-1-(2,2,2-trifluoroethyl)-4,5-dihydropurin-7-yl]propanamide |
|---|---|
| PubChem CID | 139269393 |
| Molecular Formula | C23H24F3N9O3S |
| Molecular Weight | 563.57 g/mol |
| Exact Mass | 563.17 |
| IUPAC Name | (2S)-N-[2-[2-(3-azabicyclo[3.1.0]hexan-3-yl)pyrimidin-5-yl]-1,3-thiazol-4-yl]-2-[3-methyl-2,6-dioxo-1-(2,2,2-trifluoroethyl)-4,5-dihydropurin-7-yl]propanamide |
| SMILES | C[C@@H](C(=O)Nc1csc(-c2cnc(N3CC4CC4C3)nc2)n1)N1C=NC2C1C(=O)N(CC(F)(F)F)C(=O)N2C |
| InChI | InChI=1S/C23H24F3N9O3S/c1-11(35-10-29-17-16(35)20(37)34(9-23(24,25)26)22(38)32(17)2)18(36)30-15-8-39-19(31-15)14-4-27-21(28-5-14)33-6-12-3-13(12)7-33/h4-5,8,10-13,16-17H,3,6-7,9H2,1-2H3,(H,30,36)/t11-,12?,13?,16?,17?/m0/s1 |
| InChIKey | ZVPUKFKXDNCNFK-FQROODSSSA-N |
| XLogP | 1.88 |
| TPSA | 127.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.57 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |