C24H26F3N9O3S — CID 139269394
(2S)-N-[2-[2-(3-azabicyclo[3.1.0]hexan-3-yl)pyrimidin-5-yl]-1,3-thiazol-4-yl]-2-[3-methyl-2,6-dioxo-1-(3,3,3-trifluoropropyl)-4,5-dihydropurin-7-yl]propanamide (PubChem CID 139269394) has the molecular formula C24H26F3N9O3S and a molecular weight of 577.59 g/mol. Its IUPAC name is (2S)-N-[2-[2-(3-azabicyclo[3.1.0]hexan-3-yl)pyrimidin-5-yl]-1,3-thiazol-4-yl]-2-[3-methyl-2,6-dioxo-1-(3,3,3-trifluoropropyl)-4,5-dihydropurin-7-yl]propanamide.
| Compound Name | (2S)-N-[2-[2-(3-azabicyclo[3.1.0]hexan-3-yl)pyrimidin-5-yl]-1,3-thiazol-4-yl]-2-[3-methyl-2,6-dioxo-1-(3,3,3-trifluoropropyl)-4,5-dihydropurin-7-yl]propanamide |
|---|---|
| PubChem CID | 139269394 |
| Molecular Formula | C24H26F3N9O3S |
| Molecular Weight | 577.59 g/mol |
| Exact Mass | 577.18 |
| IUPAC Name | (2S)-N-[2-[2-(3-azabicyclo[3.1.0]hexan-3-yl)pyrimidin-5-yl]-1,3-thiazol-4-yl]-2-[3-methyl-2,6-dioxo-1-(3,3,3-trifluoropropyl)-4,5-dihydropurin-7-yl]propanamide |
| SMILES | C[C@@H](C(=O)Nc1csc(-c2cnc(N3CC4CC4C3)nc2)n1)N1C=NC2C1C(=O)N(CCC(F)(F)F)C(=O)N2C |
| InChI | InChI=1S/C24H26F3N9O3S/c1-12(36-11-30-18-17(36)21(38)35(23(39)33(18)2)4-3-24(25,26)27)19(37)31-16-10-40-20(32-16)15-6-28-22(29-7-15)34-8-13-5-14(13)9-34/h6-7,10-14,17-18H,3-5,8-9H2,1-2H3,(H,31,37)/t12-,13?,14?,17?,18?/m0/s1 |
| InChIKey | NOLHGAQHAZRKIQ-FUXPSZTNSA-N |
| XLogP | 2.27 |
| TPSA | 127.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.59 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |