C13H16N7O4+ — CID 139269398
(2S)-2-[3-methyl-1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-2,6-dioxo-5H-purin-7-ium-7-yl]propanamide (PubChem CID 139269398) has the molecular formula C13H16N7O4+ and a molecular weight of 334.32 g/mol. Its IUPAC name is (2S)-2-[3-methyl-1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-2,6-dioxo-5H-purin-7-ium-7-yl]propanamide.
| Compound Name | (2S)-2-[3-methyl-1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-2,6-dioxo-5H-purin-7-ium-7-yl]propanamide |
|---|---|
| PubChem CID | 139269398 |
| Molecular Formula | C13H16N7O4+ |
| Molecular Weight | 334.32 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | (2S)-2-[3-methyl-1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-2,6-dioxo-5H-purin-7-ium-7-yl]propanamide |
| SMILES | Cc1noc(CN2C(=O)C3C(=NC=[N+]3[C@@H](C)C(N)=O)N(C)C2=O)n1 |
| InChI | InChI=1S/C13H15N7O4/c1-6(10(14)21)20-5-15-11-9(20)12(22)19(13(23)18(11)3)4-8-16-7(2)17-24-8/h5-6,9H,4H2,1-3H3,(H-,14,21)/p+1/t6-,9?/m0/s1 |
| InChIKey | LJHYFRIWYZVPGD-AADKRJSRSA-O |
| XLogP | -1.53 |
| TPSA | 138.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.32 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|