C21H19F6N7O3S — CID 139269446
(2S)-2-[3-methyl-2,6-dioxo-1-(2,2,2-trifluoroethyl)-4,5-dihydropurin-7-yl]-N-[2-[5-methyl-6-(trifluoromethyl)-3-pyridinyl]-1,3-thiazol-4-yl]propanamide (PubChem CID 139269446) has the molecular formula C21H19F6N7O3S and a molecular weight of 563.48 g/mol. Its IUPAC name is (2S)-2-[3-methyl-2,6-dioxo-1-(2,2,2-trifluoroethyl)-4,5-dihydropurin-7-yl]-N-[2-[5-methyl-6-(trifluoromethyl)-3-pyridinyl]-1,3-thiazol-4-yl]propanamide.
| Compound Name | (2S)-2-[3-methyl-2,6-dioxo-1-(2,2,2-trifluoroethyl)-4,5-dihydropurin-7-yl]-N-[2-[5-methyl-6-(trifluoromethyl)-3-pyridinyl]-1,3-thiazol-4-yl]propanamide |
|---|---|
| PubChem CID | 139269446 |
| Molecular Formula | C21H19F6N7O3S |
| Molecular Weight | 563.48 g/mol |
| Exact Mass | 563.12 |
| IUPAC Name | (2S)-2-[3-methyl-2,6-dioxo-1-(2,2,2-trifluoroethyl)-4,5-dihydropurin-7-yl]-N-[2-[5-methyl-6-(trifluoromethyl)-3-pyridinyl]-1,3-thiazol-4-yl]propanamide |
| SMILES | Cc1cc(-c2nc(NC(=O)[C@H](C)N3C=NC4C3C(=O)N(CC(F)(F)F)C(=O)N4C)cs2)cnc1C(F)(F)F |
| InChI | InChI=1S/C21H19F6N7O3S/c1-9-4-11(5-28-14(9)21(25,26)27)17-31-12(6-38-17)30-16(35)10(2)34-8-29-15-13(34)18(36)33(7-20(22,23)24)19(37)32(15)3/h4-6,8,10,13,15H,7H2,1-3H3,(H,30,35)/t10-,13?,15?/m0/s1 |
| InChIKey | PSMFLORHYBIMOE-KKJMOOEGSA-N |
| XLogP | 3.35 |
| TPSA | 111.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.48 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |