About (2S)-2-[3-methyl-2,6-dioxo-1-(2-oxobutyl)-5H-purin-7-ium-7-yl]propanamide
(2S)-2-[3-methyl-2,6-dioxo-1-(2-oxobutyl)-5H-purin-7-ium-7-yl]propanamide (PubChem CID 139269525) has the molecular formula C13H18N5O4+
and a molecular weight of 308.32 g/mol. Its IUPAC name is (2S)-2-[3-methyl-2,6-dioxo-1-(2-oxobutyl)-5H-purin-7-ium-7-yl]propanamide.
Molecular Properties
| Compound Name | (2S)-2-[3-methyl-2,6-dioxo-1-(2-oxobutyl)-5H-purin-7-ium-7-yl]propanamide |
| PubChem CID | 139269525 |
| Molecular Formula | C13H18N5O4+ |
| Molecular Weight | 308.32 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | (2S)-2-[3-methyl-2,6-dioxo-1-(2-oxobutyl)-5H-purin-7-ium-7-yl]propanamide |
| SMILES | CCC(=O)CN1C(=O)C2C(=NC=[N+]2[C@@H](C)C(N)=O)N(C)C1=O |
| InChI | InChI=1S/C13H17N5O4/c1-4-8(19)5-17-12(21)9-11(16(3)13(17)22)15-6-18(9)7(2)10(14)20/h6-7,9H,4-5H2,1-3H3,(H-,14,20)/p+1/t7-,9?/m0/s1 |
| InChIKey | HMSNMGOPLGJAPC-JAVCKPHESA-O |
| XLogP | -1.45 |
| TPSA | 116.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.32 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-[3-methyl-2,6-dioxo-1-(2-oxobutyl)-5H-purin-7-ium-7-yl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[3-methyl-2,6-dioxo-1-(2-oxobutyl)-5H-purin-7-ium-7-yl]propanamide?
The IUPAC name of (2S)-2-[3-methyl-2,6-dioxo-1-(2-oxobutyl)-5H-purin-7-ium-7-yl]propanamide (CID 139269525) is (2S)-2-[3-methyl-2,6-dioxo-1-(2-oxobutyl)-5H-purin-7-ium-7-yl]propanamide.
What is the SMILES notation for (2S)-2-[3-methyl-2,6-dioxo-1-(2-oxobutyl)-5H-purin-7-ium-7-yl]propanamide?
The canonical SMILES for (2S)-2-[3-methyl-2,6-dioxo-1-(2-oxobutyl)-5H-purin-7-ium-7-yl]propanamide is CCC(=O)CN1C(=O)C2C(=NC=[N+]2[C@@H](C)C(N)=O)N(C)C1=O.
What is the InChIKey of (2S)-2-[3-methyl-2,6-dioxo-1-(2-oxobutyl)-5H-purin-7-ium-7-yl]propanamide?
The InChIKey is HMSNMGOPLGJAPC-JAVCKPHESA-O. The full InChI is InChI=1S/C13H17N5O4/c1-4-8(19)5-17-12(21)9-11(16(3)13(17)22)15-6-18(9)7(2)10(14)20/h6-7,9H,4-5H2,1-3H3,(H-,14,20)/p+1/t7-,9?/m0/s1.
What are the key properties of (2S)-2-[3-methyl-2,6-dioxo-1-(2-oxobutyl)-5H-purin-7-ium-7-yl]propanamide?
(2S)-2-[3-methyl-2,6-dioxo-1-(2-oxobutyl)-5H-purin-7-ium-7-yl]propanamide has a molecular weight of 308.32 g/mol, XLogP of -1.45, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[3-methyl-2,6-dioxo-1-(2-oxobutyl)-5H-purin-7-ium-7-yl]propanamide is sourced from PubChem (CID 139269525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).