C35H36O2 — CID 139269610
5,5'-bis(2,4,6-trimethylphenyl)-3,3'-spirobi[1,2-dihydroindene]-4,4'-diol (PubChem CID 139269610) has the molecular formula C35H36O2 and a molecular weight of 488.67 g/mol. Its IUPAC name is 5,5'-bis(2,4,6-trimethylphenyl)-3,3'-spirobi[1,2-dihydroindene]-4,4'-diol.
| Compound Name | 5,5'-bis(2,4,6-trimethylphenyl)-3,3'-spirobi[1,2-dihydroindene]-4,4'-diol |
|---|---|
| PubChem CID | 139269610 |
| Molecular Formula | C35H36O2 |
| Molecular Weight | 488.67 g/mol |
| Exact Mass | 488.27 |
| IUPAC Name | 5,5'-bis(2,4,6-trimethylphenyl)-3,3'-spirobi[1,2-dihydroindene]-4,4'-diol |
| SMILES | Cc1cc(C)c(-c2ccc3c(c2O)C2(CC3)CCc3ccc(-c4c(C)cc(C)cc4C)c(O)c32)c(C)c1 |
| InChI | InChI=1S/C35H36O2/c1-19-15-21(3)29(22(4)16-19)27-9-7-25-11-13-35(31(25)33(27)36)14-12-26-8-10-28(34(37)32(26)35)30-23(5)17-20(2)18-24(30)6/h7-10,15-18,36-37H,11-14H2,1-6H3 |
| InChIKey | UEKPGZQKIMOLHM-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.67 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |