C6H8N2O2S — CID 139269833
2-amino-5-methylpyridine-3-sulfinic acid (PubChem CID 139269833) has the molecular formula C6H8N2O2S and a molecular weight of 172.21 g/mol. Its IUPAC name is 2-amino-5-methylpyridine-3-sulfinic acid.
| Compound Name | 2-amino-5-methylpyridine-3-sulfinic acid |
|---|---|
| PubChem CID | 139269833 |
| Molecular Formula | C6H8N2O2S |
| Molecular Weight | 172.21 g/mol |
| Exact Mass | 172.03 |
| IUPAC Name | 2-amino-5-methylpyridine-3-sulfinic acid |
| SMILES | Cc1cnc(N)c(S(=O)O)c1 |
| InChI | InChI=1S/C6H8N2O2S/c1-4-2-5(11(9)10)6(7)8-3-4/h2-3H,1H3,(H2,7,8)(H,9,10) |
| InChIKey | CVZLPDOKBNOFQY-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.21 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|