C16H9F5Fe — CID 139270124
cyclopenta-1,3-diene;1-cyclopenta-2,4-dien-1-yl-2,3,4,5,6-pentafluorobenzene;iron(2+) (PubChem CID 139270124) has the molecular formula C16H9F5Fe and a molecular weight of 352.08 g/mol. Its IUPAC name is cyclopenta-1,3-diene;1-cyclopenta-2,4-dien-1-yl-2,3,4,5,6-pentafluorobenzene;iron(2+).
| Compound Name | cyclopenta-1,3-diene;1-cyclopenta-2,4-dien-1-yl-2,3,4,5,6-pentafluorobenzene;iron(2+) |
|---|---|
| PubChem CID | 139270124 |
| Molecular Formula | C16H9F5Fe |
| Molecular Weight | 352.08 g/mol |
| Exact Mass | 352.00 |
| IUPAC Name | cyclopenta-1,3-diene;1-cyclopenta-2,4-dien-1-yl-2,3,4,5,6-pentafluorobenzene;iron(2+) |
| SMILES | Fc1c(F)c(F)c(-[c-]2cccc2)c(F)c1F.[Fe+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C11H4F5.C5H5.Fe/c12-7-6(5-3-1-2-4-5)8(13)10(15)11(16)9(7)14;1-2-4-5-3-1;/h1-4H;1-5H;/q2*-1;+2 |
| InChIKey | QATAHIIJFUDMKG-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.08 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|