About 7-propylsulfonylpurine
7-propylsulfonylpurine (PubChem CID 139270307) has the molecular formula C8H10N4O2S
and a molecular weight of 226.26 g/mol. Its IUPAC name is 7-propylsulfonylpurine.
Molecular Properties
| Compound Name | 7-propylsulfonylpurine |
| PubChem CID | 139270307 |
| Molecular Formula | C8H10N4O2S |
| Molecular Weight | 226.26 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | 7-propylsulfonylpurine |
| SMILES | CCCS(=O)(=O)n1cnc2ncncc21 |
| InChI | InChI=1S/C8H10N4O2S/c1-2-3-15(13,14)12-6-11-8-7(12)4-9-5-10-8/h4-6H,2-3H2,1H3 |
| InChIKey | GLWIQQBLIXYUSS-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 77.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.26 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 7-propylsulfonylpurine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-propylsulfonylpurine?
The IUPAC name of 7-propylsulfonylpurine (CID 139270307) is 7-propylsulfonylpurine.
What is the SMILES notation for 7-propylsulfonylpurine?
The canonical SMILES for 7-propylsulfonylpurine is CCCS(=O)(=O)n1cnc2ncncc21.
What is the InChIKey of 7-propylsulfonylpurine?
The InChIKey is GLWIQQBLIXYUSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4O2S/c1-2-3-15(13,14)12-6-11-8-7(12)4-9-5-10-8/h4-6H,2-3H2,1H3.
What are the key properties of 7-propylsulfonylpurine?
7-propylsulfonylpurine has a molecular weight of 226.26 g/mol, XLogP of 0.41, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-propylsulfonylpurine is sourced from PubChem (CID 139270307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).