C7H10N2O3 — CID 139270399
5-(1-methoxyethyl)-1H-pyrazole-3-carboxylic acid (PubChem CID 139270399) has the molecular formula C7H10N2O3 and a molecular weight of 170.17 g/mol. Its IUPAC name is 5-(1-methoxyethyl)-1H-pyrazole-3-carboxylic acid.
| Compound Name | 5-(1-methoxyethyl)-1H-pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 139270399 |
| Molecular Formula | C7H10N2O3 |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | 5-(1-methoxyethyl)-1H-pyrazole-3-carboxylic acid |
| SMILES | COC(C)c1cc(C(=O)O)n[nH]1 |
| InChI | InChI=1S/C7H10N2O3/c1-4(12-2)5-3-6(7(10)11)9-8-5/h3-4H,1-2H3,(H,8,9)(H,10,11) |
| InChIKey | DOSDSXMQBSPDHT-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |