C4H4N8 — CID 139291528
5-(5-imino-1,2,4-triazol-3-yl)-1H-1,2,4-triazol-3-amine (PubChem CID 139291528) has the molecular formula C4H4N8 and a molecular weight of 164.13 g/mol. Its IUPAC name is 5-(5-imino-1,2,4-triazol-3-yl)-1H-1,2,4-triazol-3-amine.
| Compound Name | 5-(5-imino-1,2,4-triazol-3-yl)-1H-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 139291528 |
| Molecular Formula | C4H4N8 |
| Molecular Weight | 164.13 g/mol |
| Exact Mass | 164.06 |
| IUPAC Name | 5-(5-imino-1,2,4-triazol-3-yl)-1H-1,2,4-triazol-3-amine |
| SMILES | [H]/N=C1\N=NC(c2nc(N)n[nH]2)=N1 |
| InChI | InChI=1S/C4H4N8/c5-3-7-1(9-11-3)2-8-4(6)12-10-2/h5H,(H3,6,8,10,12)/b5-3- |
| InChIKey | IQAVKJVLCSYRNJ-HYXAFXHYSA-N |
| XLogP | -0.47 |
| TPSA | 128.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.13 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|