About 5-[[(E)-N-(1,3-benzothiazol-2-yl)-C-methylsulfanylcarbonimidoyl]amino]-2-hydroxybenzoic acid
5-[[(E)-N-(1,3-benzothiazol-2-yl)-C-methylsulfanylcarbonimidoyl]amino]-2-hydroxybenzoic acid (PubChem CID 139291616) has the molecular formula C16H13N3O3S2
and a molecular weight of 359.43 g/mol. Its IUPAC name is 5-[[(E)-N-(1,3-benzothiazol-2-yl)-C-methylsulfanylcarbonimidoyl]amino]-2-hydroxybenzoic acid.
Molecular Properties
| Compound Name | 5-[[(E)-N-(1,3-benzothiazol-2-yl)-C-methylsulfanylcarbonimidoyl]amino]-2-hydroxybenzoic acid |
| PubChem CID | 139291616 |
| Molecular Formula | C16H13N3O3S2 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.04 |
| IUPAC Name | 5-[[(E)-N-(1,3-benzothiazol-2-yl)-C-methylsulfanylcarbonimidoyl]amino]-2-hydroxybenzoic acid |
| SMILES | CS/C(=N/c1nc2ccccc2s1)Nc1ccc(O)c(C(=O)O)c1 |
| InChI | InChI=1S/C16H13N3O3S2/c1-23-15(17-9-6-7-12(20)10(8-9)14(21)22)19-16-18-11-4-2-3-5-13(11)24-16/h2-8,20H,1H3,(H,21,22)(H,17,18,19) |
| InChIKey | MGWBHEAMICUQIT-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 94.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 5-[[(E)-N-(1,3-benzothiazol-2-yl)-C-methylsulfanylcarbonimidoyl]amino]-2-hydroxybenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[(E)-N-(1,3-benzothiazol-2-yl)-C-methylsulfanylcarbonimidoyl]amino]-2-hydroxybenzoic acid?
The IUPAC name of 5-[[(E)-N-(1,3-benzothiazol-2-yl)-C-methylsulfanylcarbonimidoyl]amino]-2-hydroxybenzoic acid (CID 139291616) is 5-[[(E)-N-(1,3-benzothiazol-2-yl)-C-methylsulfanylcarbonimidoyl]amino]-2-hydroxybenzoic acid.
What is the SMILES notation for 5-[[(E)-N-(1,3-benzothiazol-2-yl)-C-methylsulfanylcarbonimidoyl]amino]-2-hydroxybenzoic acid?
The canonical SMILES for 5-[[(E)-N-(1,3-benzothiazol-2-yl)-C-methylsulfanylcarbonimidoyl]amino]-2-hydroxybenzoic acid is CS/C(=N/c1nc2ccccc2s1)Nc1ccc(O)c(C(=O)O)c1.
What is the InChIKey of 5-[[(E)-N-(1,3-benzothiazol-2-yl)-C-methylsulfanylcarbonimidoyl]amino]-2-hydroxybenzoic acid?
The InChIKey is MGWBHEAMICUQIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13N3O3S2/c1-23-15(17-9-6-7-12(20)10(8-9)14(21)22)19-16-18-11-4-2-3-5-13(11)24-16/h2-8,20H,1H3,(H,21,22)(H,17,18,19).
What are the key properties of 5-[[(E)-N-(1,3-benzothiazol-2-yl)-C-methylsulfanylcarbonimidoyl]amino]-2-hydroxybenzoic acid?
5-[[(E)-N-(1,3-benzothiazol-2-yl)-C-methylsulfanylcarbonimidoyl]amino]-2-hydroxybenzoic acid has a molecular weight of 359.43 g/mol, XLogP of 4.16, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[(E)-N-(1,3-benzothiazol-2-yl)-C-methylsulfanylcarbonimidoyl]amino]-2-hydroxybenzoic acid is sourced from PubChem (CID 139291616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).