About [3,5-bis(pyridine-3-carbonyloxymethyl)phenyl]methyl pyridine-3-carboxylate
[3,5-bis(pyridine-3-carbonyloxymethyl)phenyl]methyl pyridine-3-carboxylate (PubChem CID 139291681) has the molecular formula C27H21N3O6
and a molecular weight of 483.48 g/mol. Its IUPAC name is [3,5-bis(pyridine-3-carbonyloxymethyl)phenyl]methyl pyridine-3-carboxylate.
Molecular Properties
| Compound Name | [3,5-bis(pyridine-3-carbonyloxymethyl)phenyl]methyl pyridine-3-carboxylate |
| PubChem CID | 139291681 |
| Molecular Formula | C27H21N3O6 |
| Molecular Weight | 483.48 g/mol |
| Exact Mass | 483.14 |
| IUPAC Name | [3,5-bis(pyridine-3-carbonyloxymethyl)phenyl]methyl pyridine-3-carboxylate |
| SMILES | O=C(OCc1cc(COC(=O)c2cccnc2)cc(COC(=O)c2cccnc2)c1)c1cccnc1 |
| InChI | InChI=1S/C27H21N3O6/c31-25(22-4-1-7-28-13-22)34-16-19-10-20(17-35-26(32)23-5-2-8-29-14-23)12-21(11-19)18-36-27(33)24-6-3-9-30-15-24/h1-15H,16-18H2 |
| InChIKey | CWGYJBJPKUDVST-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 117.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 483.48 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze [3,5-bis(pyridine-3-carbonyloxymethyl)phenyl]methyl pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3,5-bis(pyridine-3-carbonyloxymethyl)phenyl]methyl pyridine-3-carboxylate?
The IUPAC name of [3,5-bis(pyridine-3-carbonyloxymethyl)phenyl]methyl pyridine-3-carboxylate (CID 139291681) is [3,5-bis(pyridine-3-carbonyloxymethyl)phenyl]methyl pyridine-3-carboxylate.
What is the SMILES notation for [3,5-bis(pyridine-3-carbonyloxymethyl)phenyl]methyl pyridine-3-carboxylate?
The canonical SMILES for [3,5-bis(pyridine-3-carbonyloxymethyl)phenyl]methyl pyridine-3-carboxylate is O=C(OCc1cc(COC(=O)c2cccnc2)cc(COC(=O)c2cccnc2)c1)c1cccnc1.
What is the InChIKey of [3,5-bis(pyridine-3-carbonyloxymethyl)phenyl]methyl pyridine-3-carboxylate?
The InChIKey is CWGYJBJPKUDVST-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H21N3O6/c31-25(22-4-1-7-28-13-22)34-16-19-10-20(17-35-26(32)23-5-2-8-29-14-23)12-21(11-19)18-36-27(33)24-6-3-9-30-15-24/h1-15H,16-18H2.
What are the key properties of [3,5-bis(pyridine-3-carbonyloxymethyl)phenyl]methyl pyridine-3-carboxylate?
[3,5-bis(pyridine-3-carbonyloxymethyl)phenyl]methyl pyridine-3-carboxylate has a molecular weight of 483.48 g/mol, XLogP of 3.94, 9 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for [3,5-bis(pyridine-3-carbonyloxymethyl)phenyl]methyl pyridine-3-carboxylate is sourced from PubChem (CID 139291681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).