C19H30O2 — CID 139292243
(4aR,5S,6S)-5-butyl-6-[(1R,3S)-3-hydroxycyclopentyl]-4,4a,5,6,7,8-hexahydro-3H-naphthalen-2-one (PubChem CID 139292243) has the molecular formula C19H30O2 and a molecular weight of 290.45 g/mol. Its IUPAC name is (4aR,5S,6S)-5-butyl-6-[(1R,3S)-3-hydroxycyclopentyl]-4,4a,5,6,7,8-hexahydro-3H-naphthalen-2-one.
| Compound Name | (4aR,5S,6S)-5-butyl-6-[(1R,3S)-3-hydroxycyclopentyl]-4,4a,5,6,7,8-hexahydro-3H-naphthalen-2-one |
|---|---|
| PubChem CID | 139292243 |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | (4aR,5S,6S)-5-butyl-6-[(1R,3S)-3-hydroxycyclopentyl]-4,4a,5,6,7,8-hexahydro-3H-naphthalen-2-one |
| SMILES | CCCC[C@H]1[C@H]([C@@H]2CC[C@H](O)C2)CCC2=CC(=O)CC[C@@H]21 |
| InChI | InChI=1S/C19H30O2/c1-2-3-4-19-17(13-5-7-15(20)11-13)9-6-14-12-16(21)8-10-18(14)19/h12-13,15,17-20H,2-11H2,1H3/t13-,15+,17+,18+,19+/m1/s1 |
| InChIKey | DYFMENUVYJGCTL-CRWDZZMISA-N |
| XLogP | 4.27 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |