C23H33F2IO — CID 139292389
2-[difluoro-[4-(4-methylcyclohexyl)cyclohexyl]methoxy]-7-iodo-5,7-dimethylcyclohepta-1,3,5-triene (PubChem CID 139292389) has the molecular formula C23H33F2IO and a molecular weight of 490.42 g/mol. Its IUPAC name is 2-[difluoro-[4-(4-methylcyclohexyl)cyclohexyl]methoxy]-7-iodo-5,7-dimethylcyclohepta-1,3,5-triene.
| Compound Name | 2-[difluoro-[4-(4-methylcyclohexyl)cyclohexyl]methoxy]-7-iodo-5,7-dimethylcyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 139292389 |
| Molecular Formula | C23H33F2IO |
| Molecular Weight | 490.42 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | 2-[difluoro-[4-(4-methylcyclohexyl)cyclohexyl]methoxy]-7-iodo-5,7-dimethylcyclohepta-1,3,5-triene |
| SMILES | CC1=CC(C)(I)C=C(OC(F)(F)C2CCC(C3CCC(C)CC3)CC2)C=C1 |
| InChI | InChI=1S/C23H33F2IO/c1-16-4-7-18(8-5-16)19-9-11-20(12-10-19)23(24,25)27-21-13-6-17(2)14-22(3,26)15-21/h6,13-16,18-20H,4-5,7-12H2,1-3H3 |
| InChIKey | PJKKWRCUNPIMTL-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.42 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|