About 1-butyl-3,4-dihydroxy-5-phenylmethoxy-6-(phenylmethoxymethyl)piperidin-2-one
1-butyl-3,4-dihydroxy-5-phenylmethoxy-6-(phenylmethoxymethyl)piperidin-2-one (PubChem CID 139292660) has the molecular formula C24H31NO5
and a molecular weight of 413.51 g/mol. Its IUPAC name is 1-butyl-3,4-dihydroxy-5-phenylmethoxy-6-(phenylmethoxymethyl)piperidin-2-one.
Molecular Properties
| Compound Name | 1-butyl-3,4-dihydroxy-5-phenylmethoxy-6-(phenylmethoxymethyl)piperidin-2-one |
| PubChem CID | 139292660 |
| Molecular Formula | C24H31NO5 |
| Molecular Weight | 413.51 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | 1-butyl-3,4-dihydroxy-5-phenylmethoxy-6-(phenylmethoxymethyl)piperidin-2-one |
| SMILES | CCCCN1C(=O)C(O)C(O)C(OCc2ccccc2)C1COCc1ccccc1 |
| InChI | InChI=1S/C24H31NO5/c1-2-3-14-25-20(17-29-15-18-10-6-4-7-11-18)23(21(26)22(27)24(25)28)30-16-19-12-8-5-9-13-19/h4-13,20-23,26-27H,2-3,14-17H2,1H3 |
| InChIKey | VDMIKMHRZTWQDO-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.51 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-butyl-3,4-dihydroxy-5-phenylmethoxy-6-(phenylmethoxymethyl)piperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-3,4-dihydroxy-5-phenylmethoxy-6-(phenylmethoxymethyl)piperidin-2-one?
The IUPAC name of 1-butyl-3,4-dihydroxy-5-phenylmethoxy-6-(phenylmethoxymethyl)piperidin-2-one (CID 139292660) is 1-butyl-3,4-dihydroxy-5-phenylmethoxy-6-(phenylmethoxymethyl)piperidin-2-one.
What is the SMILES notation for 1-butyl-3,4-dihydroxy-5-phenylmethoxy-6-(phenylmethoxymethyl)piperidin-2-one?
The canonical SMILES for 1-butyl-3,4-dihydroxy-5-phenylmethoxy-6-(phenylmethoxymethyl)piperidin-2-one is CCCCN1C(=O)C(O)C(O)C(OCc2ccccc2)C1COCc1ccccc1.
What is the InChIKey of 1-butyl-3,4-dihydroxy-5-phenylmethoxy-6-(phenylmethoxymethyl)piperidin-2-one?
The InChIKey is VDMIKMHRZTWQDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H31NO5/c1-2-3-14-25-20(17-29-15-18-10-6-4-7-11-18)23(21(26)22(27)24(25)28)30-16-19-12-8-5-9-13-19/h4-13,20-23,26-27H,2-3,14-17H2,1H3.
What are the key properties of 1-butyl-3,4-dihydroxy-5-phenylmethoxy-6-(phenylmethoxymethyl)piperidin-2-one?
1-butyl-3,4-dihydroxy-5-phenylmethoxy-6-(phenylmethoxymethyl)piperidin-2-one has a molecular weight of 413.51 g/mol, XLogP of 2.52, 10 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-3,4-dihydroxy-5-phenylmethoxy-6-(phenylmethoxymethyl)piperidin-2-one is sourced from PubChem (CID 139292660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).